C21H39N — CID 167024658
(4E,11Z,13E)-N-ethyl-2,8,14-trimethylhexadeca-4,11,13-trien-6-amine (PubChem CID 167024658) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is (4E,11Z,13E)-N-ethyl-2,8,14-trimethylhexadeca-4,11,13-trien-6-amine.
| Compound Name | (4E,11Z,13E)-N-ethyl-2,8,14-trimethylhexadeca-4,11,13-trien-6-amine |
|---|---|
| PubChem CID | 167024658 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | (4E,11Z,13E)-N-ethyl-2,8,14-trimethylhexadeca-4,11,13-trien-6-amine |
| SMILES | CCNC(/C=C/CC(C)C)CC(C)CC/C=C\C=C(/C)CC |
| InChI | InChI=1S/C21H39N/c1-7-19(5)14-10-9-11-15-20(6)17-21(22-8-2)16-12-13-18(3)4/h9-10,12,14,16,18,20-22H,7-8,11,13,15,17H2,1-6H3/b10-9-,16-12+,19-14+ |
| InChIKey | XTTYPWZLAXSFQG-NXMMPRPHSA-N |
| XLogP | 6.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|