C27H27N3O4S — CID 167027988
3-[2-[(1R,2R)-2-(6,11-dihydrobenzo[c][1]benzothiepin-10-yloxymethyl)cyclopropyl]ethyl]-5-hydroxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 167027988) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is 3-[2-[(1R,2R)-2-(6,11-dihydrobenzo[c][1]benzothiepin-10-yloxymethyl)cyclopropyl]ethyl]-5-hydroxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-[2-[(1R,2R)-2-(6,11-dihydrobenzo[c][1]benzothiepin-10-yloxymethyl)cyclopropyl]ethyl]-5-hydroxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 167027988 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-[2-[(1R,2R)-2-(6,11-dihydrobenzo[c][1]benzothiepin-10-yloxymethyl)cyclopropyl]ethyl]-5-hydroxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2NCN1CC[C@H]1C[C@H]1COc1cccc2c1Cc1ccccc1SC2 |
| InChI | InChI=1S/C27H27N3O4S/c31-22-9-11-30-25(26(22)32)27(33)29(16-28-30)10-8-17-12-20(17)14-34-23-6-3-5-19-15-35-24-7-2-1-4-18(24)13-21(19)23/h1-7,9,11,17,20,28,32H,8,10,12-16H2/t17-,20-/m0/s1 |
| InChIKey | GTOOVCITTQWHHB-PXNSSMCTSA-N |
| XLogP | 3.81 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |