C11H19N3O5 — CID 167041407
N-[(2S)-3-amino-3-oxo-2-(4-oxobutanoylamino)propyl]-4-hydroxybutanamide (PubChem CID 167041407) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[(2S)-3-amino-3-oxo-2-(4-oxobutanoylamino)propyl]-4-hydroxybutanamide.
| Compound Name | N-[(2S)-3-amino-3-oxo-2-(4-oxobutanoylamino)propyl]-4-hydroxybutanamide |
|---|---|
| PubChem CID | 167041407 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[(2S)-3-amino-3-oxo-2-(4-oxobutanoylamino)propyl]-4-hydroxybutanamide |
| SMILES | NC(=O)[C@H](CNC(=O)CCCO)NC(=O)CCC=O |
| InChI | InChI=1S/C11H19N3O5/c12-11(19)8(14-10(18)4-2-6-16)7-13-9(17)3-1-5-15/h6,8,15H,1-5,7H2,(H2,12,19)(H,13,17)(H,14,18)/t8-/m0/s1 |
| InChIKey | FDDKVIXMDSVCLX-QMMMGPOBSA-N |
| XLogP | -2.18 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|