C16H24F3N5O2 — CID 167047282
1-ethyl-3-[(Z)-1,1,1-trifluoro-8-[2-(1H-imidazol-2-yl)-2-iminoethoxy]oct-5-en-4-yl]urea (PubChem CID 167047282) has the molecular formula C16H24F3N5O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is 1-ethyl-3-[(Z)-1,1,1-trifluoro-8-[2-(1H-imidazol-2-yl)-2-iminoethoxy]oct-5-en-4-yl]urea.
| Compound Name | 1-ethyl-3-[(Z)-1,1,1-trifluoro-8-[2-(1H-imidazol-2-yl)-2-iminoethoxy]oct-5-en-4-yl]urea |
|---|---|
| PubChem CID | 167047282 |
| Molecular Formula | C16H24F3N5O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-ethyl-3-[(Z)-1,1,1-trifluoro-8-[2-(1H-imidazol-2-yl)-2-iminoethoxy]oct-5-en-4-yl]urea |
| SMILES | [H]/N=C(\COCC/C=C\C(CCC(F)(F)F)NC(=O)NCC)c1ncc[nH]1 |
| InChI | InChI=1S/C16H24F3N5O2/c1-2-21-15(25)24-12(6-7-16(17,18)19)5-3-4-10-26-11-13(20)14-22-8-9-23-14/h3,5,8-9,12,20H,2,4,6-7,10-11H2,1H3,(H,22,23)(H2,21,24,25)/b5-3-,20-13+ |
| InChIKey | RFFSBEIWWRFJAT-RHQODEKDSA-N |
| XLogP | 2.77 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|