C23H36F3N5O2 — CID 163278242
[(E)-6-[[ethyl(propan-2-yl)carbamoyl]amino]-9,9,9-trifluoronon-3-enyl] 1-methyl-N-prop-1-en-2-ylimidazole-2-carboximidate (PubChem CID 163278242) has the molecular formula C23H36F3N5O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is [(E)-6-[[ethyl(propan-2-yl)carbamoyl]amino]-9,9,9-trifluoronon-3-enyl] 1-methyl-N-prop-1-en-2-ylimidazole-2-carboximidate.
| Compound Name | [(E)-6-[[ethyl(propan-2-yl)carbamoyl]amino]-9,9,9-trifluoronon-3-enyl] 1-methyl-N-prop-1-en-2-ylimidazole-2-carboximidate |
|---|---|
| PubChem CID | 163278242 |
| Molecular Formula | C23H36F3N5O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | [(E)-6-[[ethyl(propan-2-yl)carbamoyl]amino]-9,9,9-trifluoronon-3-enyl] 1-methyl-N-prop-1-en-2-ylimidazole-2-carboximidate |
| SMILES | C=C(C)/N=C(\OCC/C=C/CC(CCC(F)(F)F)NC(=O)N(CC)C(C)C)c1nccn1C |
| InChI | InChI=1S/C23H36F3N5O2/c1-7-31(18(4)5)22(32)29-19(12-13-23(24,25)26)11-9-8-10-16-33-21(28-17(2)3)20-27-14-15-30(20)6/h8-9,14-15,18-19H,2,7,10-13,16H2,1,3-6H3,(H,29,32)/b9-8+,28-21- |
| InChIKey | ZMKHNOWLMSFLFC-VQXNTPBHSA-N |
| XLogP | 5.20 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|