C20H21FN2O — CID 167054796
4-[3-fluoro-4-[5-methyl-2-[(E)-prop-1-enyl]phenyl]phenyl]-4-iminobutanamide (PubChem CID 167054796) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is 4-[3-fluoro-4-[5-methyl-2-[(E)-prop-1-enyl]phenyl]phenyl]-4-iminobutanamide.
| Compound Name | 4-[3-fluoro-4-[5-methyl-2-[(E)-prop-1-enyl]phenyl]phenyl]-4-iminobutanamide |
|---|---|
| PubChem CID | 167054796 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[3-fluoro-4-[5-methyl-2-[(E)-prop-1-enyl]phenyl]phenyl]-4-iminobutanamide |
| SMILES | [H]/N=C(\CCC(N)=O)c1ccc(-c2cc(C)ccc2/C=C/C)c(F)c1 |
| InChI | InChI=1S/C20H21FN2O/c1-3-4-14-6-5-13(2)11-17(14)16-8-7-15(12-18(16)21)19(22)9-10-20(23)24/h3-8,11-12,22H,9-10H2,1-2H3,(H2,23,24)/b4-3+,22-19+ |
| InChIKey | ZVWHYUWOZZDJFT-WJNDCCCBSA-N |
| XLogP | 4.47 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|