C17H24N2O — CID 167054950
N-octan-3-yl-4-(1,2-oxazol-3-yl)aniline (PubChem CID 167054950) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-octan-3-yl-4-(1,2-oxazol-3-yl)aniline.
| Compound Name | N-octan-3-yl-4-(1,2-oxazol-3-yl)aniline |
|---|---|
| PubChem CID | 167054950 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-octan-3-yl-4-(1,2-oxazol-3-yl)aniline |
| SMILES | CCCCCC(CC)Nc1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C17H24N2O/c1-3-5-6-7-15(4-2)18-16-10-8-14(9-11-16)17-12-13-20-19-17/h8-13,15,18H,3-7H2,1-2H3 |
| InChIKey | RSLHVPUHZVAYTB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|