C12H16F6O2 — CID 167055856
1,1,1,3,3,3-hexafluoro-2-[[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]oxymethyl]propan-2-ol (PubChem CID 167055856) has the molecular formula C12H16F6O2 and a molecular weight of 306.25 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]oxymethyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]oxymethyl]propan-2-ol |
|---|---|
| PubChem CID | 167055856 |
| Molecular Formula | C12H16F6O2 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]oxymethyl]propan-2-ol |
| SMILES | C/C=C\C(=C/C(C)C)OCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F6O2/c1-4-5-9(6-8(2)3)20-7-10(19,11(13,14)15)12(16,17)18/h4-6,8,19H,7H2,1-3H3/b5-4-,9-6+ |
| InChIKey | TZCUUEYPCLEFIW-KMOPYBJPSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|