C19H21N3O — CID 167056357
N-[3-[(1E)-1-aminobuta-1,3-dien-2-yl]phenyl]-N-[2-(dimethylamino)phenyl]formamide (PubChem CID 167056357) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is N-[3-[(1E)-1-aminobuta-1,3-dien-2-yl]phenyl]-N-[2-(dimethylamino)phenyl]formamide.
| Compound Name | N-[3-[(1E)-1-aminobuta-1,3-dien-2-yl]phenyl]-N-[2-(dimethylamino)phenyl]formamide |
|---|---|
| PubChem CID | 167056357 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[3-[(1E)-1-aminobuta-1,3-dien-2-yl]phenyl]-N-[2-(dimethylamino)phenyl]formamide |
| SMILES | C=C/C(=C\N)c1cccc(N(C=O)c2ccccc2N(C)C)c1 |
| InChI | InChI=1S/C19H21N3O/c1-4-15(13-20)16-8-7-9-17(12-16)22(14-23)19-11-6-5-10-18(19)21(2)3/h4-14H,1,20H2,2-3H3/b15-13+ |
| InChIKey | XJCPFDBHBMQOIT-FYWRMAATSA-N |
| XLogP | 3.53 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|