About N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide
N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide (PubChem CID 167057684) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide.
Molecular Properties
| Compound Name | N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide |
| PubChem CID | 167057684 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide |
| SMILES | CCC(C)(C)CCNC(=O)C(C)C(C)(CC)CC |
| InChI | InChI=1S/C16H33NO/c1-8-15(5,6)11-12-17-14(18)13(4)16(7,9-2)10-3/h13H,8-12H2,1-7H3,(H,17,18) |
| InChIKey | HSPQJHTUVJVBLA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide?
The IUPAC name of N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide (CID 167057684) is N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide.
What is the SMILES notation for N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide?
The canonical SMILES for N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide is CCC(C)(C)CCNC(=O)C(C)C(C)(CC)CC.
What is the InChIKey of N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide?
The InChIKey is HSPQJHTUVJVBLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO/c1-8-15(5,6)11-12-17-14(18)13(4)16(7,9-2)10-3/h13H,8-12H2,1-7H3,(H,17,18).
What are the key properties of N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide?
N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide has a molecular weight of 255.45 g/mol, XLogP of 4.39, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide is sourced from PubChem (CID 167057684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).