C16H33NO — CID 167057684
N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide (PubChem CID 167057684) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide.
| Compound Name | N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide |
|---|---|
| PubChem CID | 167057684 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | N-(3,3-dimethylpentyl)-3-ethyl-2,3-dimethylpentanamide |
| SMILES | CCC(C)(C)CCNC(=O)C(C)C(C)(CC)CC |
| InChI | InChI=1S/C16H33NO/c1-8-15(5,6)11-12-17-14(18)13(4)16(7,9-2)10-3/h13H,8-12H2,1-7H3,(H,17,18) |
| InChIKey | HSPQJHTUVJVBLA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |