C16H27F — CID 167060574
(3E,5Z)-3-ethyl-6-fluoro-2-methyl-5-(3-methylbut-1-en-2-yl)octa-3,5-diene (PubChem CID 167060574) has the molecular formula C16H27F and a molecular weight of 238.39 g/mol. Its IUPAC name is (3E,5Z)-3-ethyl-6-fluoro-2-methyl-5-(3-methylbut-1-en-2-yl)octa-3,5-diene.
| Compound Name | (3E,5Z)-3-ethyl-6-fluoro-2-methyl-5-(3-methylbut-1-en-2-yl)octa-3,5-diene |
|---|---|
| PubChem CID | 167060574 |
| Molecular Formula | C16H27F |
| Molecular Weight | 238.39 g/mol |
| Exact Mass | 238.21 |
| IUPAC Name | (3E,5Z)-3-ethyl-6-fluoro-2-methyl-5-(3-methylbut-1-en-2-yl)octa-3,5-diene |
| SMILES | C=C(C(/C=C(\CC)C(C)C)=C(\F)CC)C(C)C |
| InChI | InChI=1S/C16H27F/c1-8-14(12(5)6)10-15(16(17)9-2)13(7)11(3)4/h10-12H,7-9H2,1-6H3/b14-10+,16-15- |
| InChIKey | UHOKPJWNVFSMLR-MOGNNOCJSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.39 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|