C16H26S — CID 167062966
9-thiatricyclo[8.7.0.02,8]heptadec-2(8)-ene (PubChem CID 167062966) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is 9-thiatricyclo[8.7.0.02,8]heptadec-2(8)-ene.
| Compound Name | 9-thiatricyclo[8.7.0.02,8]heptadec-2(8)-ene |
|---|---|
| PubChem CID | 167062966 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 9-thiatricyclo[8.7.0.02,8]heptadec-2(8)-ene |
| SMILES | C1CCCC2SC3=C(CCCCC3)C2CCC1 |
| InChI | InChI=1S/C16H26S/c1-2-5-9-13-14-10-6-4-8-12-16(14)17-15(13)11-7-3-1/h13,15H,1-12H2 |
| InChIKey | LEUHWGPCAAKUSP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |