C48H47NO4S2 — CID 167069190
2-[[1,3-bis(tritylsulfanyl)propan-2-yloxy-hydroxymethyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 167069190) has the molecular formula C48H47NO4S2 and a molecular weight of 766.04 g/mol. Its IUPAC name is 2-[[1,3-bis(tritylsulfanyl)propan-2-yloxy-hydroxymethyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[1,3-bis(tritylsulfanyl)propan-2-yloxy-hydroxymethyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167069190 |
| Molecular Formula | C48H47NO4S2 |
| Molecular Weight | 766.04 g/mol |
| Exact Mass | 765.29 |
| IUPAC Name | 2-[[1,3-bis(tritylsulfanyl)propan-2-yloxy-hydroxymethyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(O)OC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)CSC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C48H47NO4S2/c1-37(2)45(50)52-34-33-49-46(51)53-44(35-54-47(38-21-9-3-10-22-38,39-23-11-4-12-24-39)40-25-13-5-14-26-40)36-55-48(41-27-15-6-16-28-41,42-29-17-7-18-30-42)43-31-19-8-20-32-43/h3-32,44,46,49,51H,1,33-36H2,2H3 |
| InChIKey | FIHZTYNDOLUQFD-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.04 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|