C26H24ClN3O — CID 167079722
(2Z)-2-[[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-(2,4,5-trimethylphenyl)methylidene]but-3-enenitrile (PubChem CID 167079722) has the molecular formula C26H24ClN3O and a molecular weight of 429.95 g/mol. Its IUPAC name is (2Z)-2-[[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-(2,4,5-trimethylphenyl)methylidene]but-3-enenitrile.
| Compound Name | (2Z)-2-[[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-(2,4,5-trimethylphenyl)methylidene]but-3-enenitrile |
|---|---|
| PubChem CID | 167079722 |
| Molecular Formula | C26H24ClN3O |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2Z)-2-[[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-(2,4,5-trimethylphenyl)methylidene]but-3-enenitrile |
| SMILES | C=C/C(C#N)=C(/Nc1ccc(OCc2ccccn2)c(Cl)c1)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C26H24ClN3O/c1-5-20(15-28)26(23-13-18(3)17(2)12-19(23)4)30-21-9-10-25(24(27)14-21)31-16-22-8-6-7-11-29-22/h5-14,30H,1,16H2,2-4H3/b26-20- |
| InChIKey | IAOIRUWGLUVNCH-QOMWVZHYSA-N |
| XLogP | 6.77 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|