C19H20FN — CID 167080179
N-[4-[3-(4-fluorophenyl)prop-1-en-2-yl]-2,5-dimethylphenyl]ethanimine (PubChem CID 167080179) has the molecular formula C19H20FN and a molecular weight of 281.37 g/mol. Its IUPAC name is N-[4-[3-(4-fluorophenyl)prop-1-en-2-yl]-2,5-dimethylphenyl]ethanimine.
| Compound Name | N-[4-[3-(4-fluorophenyl)prop-1-en-2-yl]-2,5-dimethylphenyl]ethanimine |
|---|---|
| PubChem CID | 167080179 |
| Molecular Formula | C19H20FN |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[4-[3-(4-fluorophenyl)prop-1-en-2-yl]-2,5-dimethylphenyl]ethanimine |
| SMILES | C=C(Cc1ccc(F)cc1)c1cc(C)c(/N=C/C)cc1C |
| InChI | InChI=1S/C19H20FN/c1-5-21-19-12-14(3)18(11-15(19)4)13(2)10-16-6-8-17(20)9-7-16/h5-9,11-12H,2,10H2,1,3-4H3/b21-5+ |
| InChIKey | KQPVAAAXKBPOEN-IGCPIRJNSA-N |
| XLogP | 5.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|