C23H27N3O8S — CID 167094539
2-[4-[7-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]quinolin-3-yl]butanoylamino]ethanesulfonic acid (PubChem CID 167094539) has the molecular formula C23H27N3O8S and a molecular weight of 505.55 g/mol. Its IUPAC name is 2-[4-[7-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]quinolin-3-yl]butanoylamino]ethanesulfonic acid.
| Compound Name | 2-[4-[7-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]quinolin-3-yl]butanoylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 167094539 |
| Molecular Formula | C23H27N3O8S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 2-[4-[7-[4-(2,5-dioxopyrrolidin-1-yl)oxy-4-oxobutyl]quinolin-3-yl]butanoylamino]ethanesulfonic acid |
| SMILES | O=C(CCCc1cnc2cc(CCCC(=O)ON3C(=O)CCC3=O)ccc2c1)NCCS(=O)(=O)O |
| InChI | InChI=1S/C23H27N3O8S/c27-20(24-11-12-35(31,32)33)5-1-4-17-13-18-8-7-16(14-19(18)25-15-17)3-2-6-23(30)34-26-21(28)9-10-22(26)29/h7-8,13-15H,1-6,9-12H2,(H,24,27)(H,31,32,33) |
| InChIKey | QXXFZZIOTXPSLL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 160.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|