C14H19ClO3S — CID 167096006
S-ethyl 2-chloro-3,5-diethoxy-4-methylbenzenecarbothioate (PubChem CID 167096006) has the molecular formula C14H19ClO3S and a molecular weight of 302.82 g/mol. Its IUPAC name is S-ethyl 2-chloro-3,5-diethoxy-4-methylbenzenecarbothioate.
| Compound Name | S-ethyl 2-chloro-3,5-diethoxy-4-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 167096006 |
| Molecular Formula | C14H19ClO3S |
| Molecular Weight | 302.82 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | S-ethyl 2-chloro-3,5-diethoxy-4-methylbenzenecarbothioate |
| SMILES | CCOc1cc(C(=O)SCC)c(Cl)c(OCC)c1C |
| InChI | InChI=1S/C14H19ClO3S/c1-5-17-11-8-10(14(16)19-7-3)12(15)13(9(11)4)18-6-2/h8H,5-7H2,1-4H3 |
| InChIKey | JISURDYGEFFMJM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|