C28H42N6O5 — CID 167096780
N-[3-[4-[4-(3-aminophenyl)triazol-1-yl]butyl]-9-methoxy-5,13-dimethyl-12,14-dioxo-1-oxa-6-azacyclotetradec-4-yl]formamide (PubChem CID 167096780) has the molecular formula C28H42N6O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is N-[3-[4-[4-(3-aminophenyl)triazol-1-yl]butyl]-9-methoxy-5,13-dimethyl-12,14-dioxo-1-oxa-6-azacyclotetradec-4-yl]formamide.
| Compound Name | N-[3-[4-[4-(3-aminophenyl)triazol-1-yl]butyl]-9-methoxy-5,13-dimethyl-12,14-dioxo-1-oxa-6-azacyclotetradec-4-yl]formamide |
|---|---|
| PubChem CID | 167096780 |
| Molecular Formula | C28H42N6O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | N-[3-[4-[4-(3-aminophenyl)triazol-1-yl]butyl]-9-methoxy-5,13-dimethyl-12,14-dioxo-1-oxa-6-azacyclotetradec-4-yl]formamide |
| SMILES | COC1CCNC(C)C(NC=O)C(CCCCn2cc(-c3cccc(N)c3)nn2)COC(=O)C(C)C(=O)CC1 |
| InChI | InChI=1S/C28H42N6O5/c1-19-26(36)11-10-24(38-3)12-13-30-20(2)27(31-18-35)22(17-39-28(19)37)7-4-5-14-34-16-25(32-33-34)21-8-6-9-23(29)15-21/h6,8-9,15-16,18-20,22,24,27,30H,4-5,7,10-14,17,29H2,1-3H3,(H,31,35) |
| InChIKey | MAFKOHUAPVMSSP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|