C34H38O4 — CID 167099195
(3R)-3-methyl-5-[2-[(2S,5S)-3-methylidene-5-(3-trityloxypropyl)oxolan-2-yl]ethyl]oxolan-2-one (PubChem CID 167099195) has the molecular formula C34H38O4 and a molecular weight of 510.67 g/mol. Its IUPAC name is (3R)-3-methyl-5-[2-[(2S,5S)-3-methylidene-5-(3-trityloxypropyl)oxolan-2-yl]ethyl]oxolan-2-one.
| Compound Name | (3R)-3-methyl-5-[2-[(2S,5S)-3-methylidene-5-(3-trityloxypropyl)oxolan-2-yl]ethyl]oxolan-2-one |
|---|---|
| PubChem CID | 167099195 |
| Molecular Formula | C34H38O4 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | (3R)-3-methyl-5-[2-[(2S,5S)-3-methylidene-5-(3-trityloxypropyl)oxolan-2-yl]ethyl]oxolan-2-one |
| SMILES | C=C1C[C@H](CCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1CCC1C[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C34H38O4/c1-25-23-30(37-32(25)21-20-31-24-26(2)33(35)38-31)19-12-22-36-34(27-13-6-3-7-14-27,28-15-8-4-9-16-28)29-17-10-5-11-18-29/h3-11,13-18,26,30-32H,1,12,19-24H2,2H3/t26-,30+,31?,32+/m1/s1 |
| InChIKey | QTXHXPWBMCJISR-SPWUBCJGSA-N |
| XLogP | 7.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|