C31H42O4Si — CID 89329051
(3R,5R)-5-[2-[(2S,5S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]ethyl]-3-methyloxolan-2-one (PubChem CID 89329051) has the molecular formula C31H42O4Si and a molecular weight of 506.76 g/mol. Its IUPAC name is (3R,5R)-5-[2-[(2S,5S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]ethyl]-3-methyloxolan-2-one.
| Compound Name | (3R,5R)-5-[2-[(2S,5S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]ethyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 89329051 |
| Molecular Formula | C31H42O4Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (3R,5R)-5-[2-[(2S,5S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]ethyl]-3-methyloxolan-2-one |
| SMILES | C=C1C[C@H](CCCCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)O[C@H]1CC[C@@H]1C[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C31H42O4Si/c1-23-21-25(34-29(23)19-18-26-22-24(2)30(32)35-26)13-11-12-20-31(3,4)36(33,27-14-7-5-8-15-27)28-16-9-6-10-17-28/h5-10,14-17,24-26,29,33H,1,11-13,18-22H2,2-4H3/t24-,25+,26-,29+/m1/s1 |
| InChIKey | ARLHDPQIMMXRNK-KGWIZABPSA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|