C32H39F3O2 — CID 167121514
1-butoxy-4-[4-[difluoro-(2-fluoro-4-pentylphenoxy)methyl]-2,3-dimethylphenyl]-2,3-dimethylbenzene (PubChem CID 167121514) has the molecular formula C32H39F3O2 and a molecular weight of 512.66 g/mol. Its IUPAC name is 1-butoxy-4-[4-[difluoro-(2-fluoro-4-pentylphenoxy)methyl]-2,3-dimethylphenyl]-2,3-dimethylbenzene.
| Compound Name | 1-butoxy-4-[4-[difluoro-(2-fluoro-4-pentylphenoxy)methyl]-2,3-dimethylphenyl]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 167121514 |
| Molecular Formula | C32H39F3O2 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 1-butoxy-4-[4-[difluoro-(2-fluoro-4-pentylphenoxy)methyl]-2,3-dimethylphenyl]-2,3-dimethylbenzene |
| SMILES | CCCCCc1ccc(OC(F)(F)c2ccc(-c3ccc(OCCCC)c(C)c3C)c(C)c2C)c(F)c1 |
| InChI | InChI=1S/C32H39F3O2/c1-7-9-11-12-25-13-17-31(29(33)20-25)37-32(34,35)28-16-14-26(21(3)23(28)5)27-15-18-30(24(6)22(27)4)36-19-10-8-2/h13-18,20H,7-12,19H2,1-6H3 |
| InChIKey | JPQSNBVYGKDQMJ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|