C22H26FNO19S2 — CID 167146415
3-[4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-6-(8-fluoro-4-methyl-2-oxochromen-7-yl)oxy-4,5-dihydroxyoxane-2-carboxylic acid (PubChem CID 167146415) has the molecular formula C22H26FNO19S2 and a molecular weight of 691.57 g/mol. Its IUPAC name is 3-[4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-6-(8-fluoro-4-methyl-2-oxochromen-7-yl)oxy-4,5-dihydroxyoxane-2-carboxylic acid.
| Compound Name | 3-[4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-6-(8-fluoro-4-methyl-2-oxochromen-7-yl)oxy-4,5-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 167146415 |
| Molecular Formula | C22H26FNO19S2 |
| Molecular Weight | 691.57 g/mol |
| Exact Mass | 691.05 |
| IUPAC Name | 3-[4,5-dihydroxy-3-(sulfoamino)-6-(sulfooxymethyl)oxan-2-yl]oxy-6-(8-fluoro-4-methyl-2-oxochromen-7-yl)oxy-4,5-dihydroxyoxane-2-carboxylic acid |
| SMILES | Cc1cc(=O)oc2c(F)c(OC3OC(C(=O)O)C(OC4OC(COS(=O)(=O)O)C(O)C(O)C4NS(=O)(=O)O)C(O)C3O)ccc12 |
| InChI | InChI=1S/C22H26FNO19S2/c1-6-4-10(25)41-17-7(6)2-3-8(11(17)23)39-22-16(29)15(28)18(19(43-22)20(30)31)42-21-12(24-44(32,33)34)14(27)13(26)9(40-21)5-38-45(35,36)37/h2-4,9,12-16,18-19,21-22,24,26-29H,5H2,1H3,(H,30,31)(H,32,33,34)(H,35,36,37) |
| InChIKey | SXVPILNEGLEQKW-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 315.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.57 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|