C28H35FN7OP — CID 167150978
N'-[1-[4-[4-(2-dimethylphosphoryl-5-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]piperidin-4-yl]-N-methylethane-1,2-diamine (PubChem CID 167150978) has the molecular formula C28H35FN7OP and a molecular weight of 535.61 g/mol. Its IUPAC name is N'-[1-[4-[4-(2-dimethylphosphoryl-5-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]piperidin-4-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[1-[4-[4-(2-dimethylphosphoryl-5-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]piperidin-4-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 167150978 |
| Molecular Formula | C28H35FN7OP |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | N'-[1-[4-[4-(2-dimethylphosphoryl-5-fluoroanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]piperidin-4-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNC1CCN(c2ccc(-c3cc4c(Nc5cc(F)ccc5P(C)(C)=O)ncnc4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C28H35FN7OP/c1-30-12-13-31-21-10-14-36(15-11-21)22-7-4-19(5-8-22)24-17-23-27(34-24)32-18-33-28(23)35-25-16-20(29)6-9-26(25)38(2,3)37/h4-9,16-18,21,30-31H,10-15H2,1-3H3,(H2,32,33,34,35) |
| InChIKey | XGHZYXBMDFZJAB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|