About [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate
[[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate (PubChem CID 167155746) has the molecular formula C17H35N3O2
and a molecular weight of 313.49 g/mol. Its IUPAC name is [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate.
Molecular Properties
| Compound Name | [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate |
| PubChem CID | 167155746 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate |
| SMILES | CCNC(NCCCN(C)C)OC(=O)C1CCCCCCC1 |
| InChI | InChI=1S/C17H35N3O2/c1-4-18-17(19-13-10-14-20(2)3)22-16(21)15-11-8-6-5-7-9-12-15/h15,17-19H,4-14H2,1-3H3 |
| InChIKey | OPNFSAKCASDLOI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate?
The IUPAC name of [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate (CID 167155746) is [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate.
What is the SMILES notation for [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate?
The canonical SMILES for [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate is CCNC(NCCCN(C)C)OC(=O)C1CCCCCCC1.
What is the InChIKey of [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate?
The InChIKey is OPNFSAKCASDLOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N3O2/c1-4-18-17(19-13-10-14-20(2)3)22-16(21)15-11-8-6-5-7-9-12-15/h15,17-19H,4-14H2,1-3H3.
What are the key properties of [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate?
[[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate has a molecular weight of 313.49 g/mol, XLogP of 2.32, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[3-(dimethylamino)propylamino]-(ethylamino)methyl] cyclooctanecarboxylate is sourced from PubChem (CID 167155746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).