C37H55NO13 — CID 167158811
4-O-[3-[3,3-dimethyl-4-(2-methylbutan-2-yloxy)-4-oxobutanoyl]oxy-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] 1-O-(4-ethyl-2-hydroxy-4-methylhexyl) benzene-1,4-dicarboxylate (PubChem CID 167158811) has the molecular formula C37H55NO13 and a molecular weight of 721.84 g/mol. Its IUPAC name is 4-O-[3-[3,3-dimethyl-4-(2-methylbutan-2-yloxy)-4-oxobutanoyl]oxy-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] 1-O-(4-ethyl-2-hydroxy-4-methylhexyl) benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[3-[3,3-dimethyl-4-(2-methylbutan-2-yloxy)-4-oxobutanoyl]oxy-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] 1-O-(4-ethyl-2-hydroxy-4-methylhexyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 167158811 |
| Molecular Formula | C37H55NO13 |
| Molecular Weight | 721.84 g/mol |
| Exact Mass | 721.37 |
| IUPAC Name | 4-O-[3-[3,3-dimethyl-4-(2-methylbutan-2-yloxy)-4-oxobutanoyl]oxy-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] 1-O-(4-ethyl-2-hydroxy-4-methylhexyl) benzene-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCNC(=O)OC(COC(=O)CC(C)(C)C(=O)OC(C)(C)CC)COC(=O)c1ccc(C(=O)OCC(O)CC(C)(CC)CC)cc1 |
| InChI | InChI=1S/C37H55NO13/c1-10-29(40)46-19-18-38-34(45)50-28(23-47-30(41)21-35(5,6)33(44)51-36(7,8)11-2)24-49-32(43)26-16-14-25(15-17-26)31(42)48-22-27(39)20-37(9,12-3)13-4/h10,14-17,27-28,39H,1,11-13,18-24H2,2-9H3,(H,38,45) |
| InChIKey | LKIVHOSENZCEJC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 190.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.84 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|