C13H23NO6 — CID 89003454
2-[[2-[hydroxy(methoxy)methyl]-2-methylbutoxy]carbonylamino]ethyl prop-2-enoate (PubChem CID 89003454) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[[2-[hydroxy(methoxy)methyl]-2-methylbutoxy]carbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[[2-[hydroxy(methoxy)methyl]-2-methylbutoxy]carbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 89003454 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-[[2-[hydroxy(methoxy)methyl]-2-methylbutoxy]carbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCC(C)(CC)C(O)OC |
| InChI | InChI=1S/C13H23NO6/c1-5-10(15)19-8-7-14-12(17)20-9-13(3,6-2)11(16)18-4/h5,11,16H,1,6-9H2,2-4H3,(H,14,17) |
| InChIKey | GGNQBYDRPJMWPX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|