C17H31F2N — CID 167169510
(2Z,4E)-4-(1,1-difluoroethyl)-N-hexan-2-yl-N,3-dimethylhepta-2,4-dien-1-amine (PubChem CID 167169510) has the molecular formula C17H31F2N and a molecular weight of 287.44 g/mol. Its IUPAC name is (2Z,4E)-4-(1,1-difluoroethyl)-N-hexan-2-yl-N,3-dimethylhepta-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-4-(1,1-difluoroethyl)-N-hexan-2-yl-N,3-dimethylhepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 167169510 |
| Molecular Formula | C17H31F2N |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (2Z,4E)-4-(1,1-difluoroethyl)-N-hexan-2-yl-N,3-dimethylhepta-2,4-dien-1-amine |
| SMILES | CC/C=C(C(\C)=C/CN(C)C(C)CCCC)/C(C)(F)F |
| InChI | InChI=1S/C17H31F2N/c1-7-9-11-15(4)20(6)13-12-14(3)16(10-8-2)17(5,18)19/h10,12,15H,7-9,11,13H2,1-6H3/b14-12-,16-10+ |
| InChIKey | LRWHFGDYEPKVHF-XYVMAKOOSA-N |
| XLogP | 5.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|