C23H24O8 — CID 16717100
[(Z,4R,5S)-5-(acetyloxymethyl)-6-benzoyloxy-4,5-dihydroxyhex-2-enyl] benzoate (PubChem CID 16717100) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is [(Z,4R,5S)-5-(acetyloxymethyl)-6-benzoyloxy-4,5-dihydroxyhex-2-enyl] benzoate.
| Compound Name | [(Z,4R,5S)-5-(acetyloxymethyl)-6-benzoyloxy-4,5-dihydroxyhex-2-enyl] benzoate |
|---|---|
| PubChem CID | 16717100 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [(Z,4R,5S)-5-(acetyloxymethyl)-6-benzoyloxy-4,5-dihydroxyhex-2-enyl] benzoate |
| SMILES | CC(=O)OC[C@](O)(COC(=O)c1ccccc1)[C@H](O)/C=C\COC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24O8/c1-17(24)30-15-23(28,16-31-22(27)19-11-6-3-7-12-19)20(25)13-8-14-29-21(26)18-9-4-2-5-10-18/h2-13,20,25,28H,14-16H2,1H3/b13-8-/t20-,23+/m1/s1 |
| InChIKey | OCQFOVJTJRPGIU-FFSPDELUSA-N |
| XLogP | 1.91 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|