C17H33N5O5 — CID 167175326
(3S)-3-[[(2S)-2-[[(2S)-6-(dimethylamino)-2-(hydroxyamino)hexanoyl]amino]propanoyl]amino]-4-oxohexanamide (PubChem CID 167175326) has the molecular formula C17H33N5O5 and a molecular weight of 387.48 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-6-(dimethylamino)-2-(hydroxyamino)hexanoyl]amino]propanoyl]amino]-4-oxohexanamide.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-6-(dimethylamino)-2-(hydroxyamino)hexanoyl]amino]propanoyl]amino]-4-oxohexanamide |
|---|---|
| PubChem CID | 167175326 |
| Molecular Formula | C17H33N5O5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-6-(dimethylamino)-2-(hydroxyamino)hexanoyl]amino]propanoyl]amino]-4-oxohexanamide |
| SMILES | CCC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCCN(C)C)NO |
| InChI | InChI=1S/C17H33N5O5/c1-5-14(23)13(10-15(18)24)20-16(25)11(2)19-17(26)12(21-27)8-6-7-9-22(3)4/h11-13,21,27H,5-10H2,1-4H3,(H2,18,24)(H,19,26)(H,20,25)/t11-,12-,13-/m0/s1 |
| InChIKey | DNWWVCFEGZIIMI-AVGNSLFASA-N |
| XLogP | -1.09 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|