C18H27N5O2 — CID 167190606
3-[2-[2-(piperidin-4-ylmethylamino)ethylamino]-4-pyridinyl]piperidine-2,6-dione (PubChem CID 167190606) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 3-[2-[2-(piperidin-4-ylmethylamino)ethylamino]-4-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[2-[2-(piperidin-4-ylmethylamino)ethylamino]-4-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167190606 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 3-[2-[2-(piperidin-4-ylmethylamino)ethylamino]-4-pyridinyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2ccnc(NCCNCC3CCNCC3)c2)C(=O)N1 |
| InChI | InChI=1S/C18H27N5O2/c24-17-2-1-15(18(25)23-17)14-5-8-21-16(11-14)22-10-9-20-12-13-3-6-19-7-4-13/h5,8,11,13,15,19-20H,1-4,6-7,9-10,12H2,(H,21,22)(H,23,24,25) |
| InChIKey | XXWUGKGBYSJCAF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|