C24H36N2O2 — CID 177364377
3-[4-(2,3-dimethyl-4-piperidin-4-ylbutyl)-3-ethylphenyl]piperidine-2,6-dione (PubChem CID 177364377) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 3-[4-(2,3-dimethyl-4-piperidin-4-ylbutyl)-3-ethylphenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-(2,3-dimethyl-4-piperidin-4-ylbutyl)-3-ethylphenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177364377 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 3-[4-(2,3-dimethyl-4-piperidin-4-ylbutyl)-3-ethylphenyl]piperidine-2,6-dione |
| SMILES | CCc1cc(C2CCC(=O)NC2=O)ccc1CC(C)C(C)CC1CCNCC1 |
| InChI | InChI=1S/C24H36N2O2/c1-4-19-15-21(22-7-8-23(27)26-24(22)28)6-5-20(19)14-17(3)16(2)13-18-9-11-25-12-10-18/h5-6,15-18,22,25H,4,7-14H2,1-3H3,(H,26,27,28) |
| InChIKey | OLYWTRSDGNGKJR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|