C21H29N5O — CID 167191436
4-[4-(1,8-diazaspiro[5.5]undecan-8-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-3,5-dimethyl-2,3-dihydro-1,2-oxazole (PubChem CID 167191436) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 4-[4-(1,8-diazaspiro[5.5]undecan-8-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-3,5-dimethyl-2,3-dihydro-1,2-oxazole.
| Compound Name | 4-[4-(1,8-diazaspiro[5.5]undecan-8-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-3,5-dimethyl-2,3-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 167191436 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 4-[4-(1,8-diazaspiro[5.5]undecan-8-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-3,5-dimethyl-2,3-dihydro-1,2-oxazole |
| SMILES | CC1=C(c2c[nH]c3nccc(N4CCCC5(CCCCN5)C4)c23)C(C)NO1 |
| InChI | InChI=1S/C21H29N5O/c1-14-18(15(2)27-25-14)16-12-23-20-19(16)17(6-10-22-20)26-11-5-8-21(13-26)7-3-4-9-24-21/h6,10,12,14,24-25H,3-5,7-9,11,13H2,1-2H3,(H,22,23) |
| InChIKey | IDZRZIAKPFBDHR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |