C18H17ClN2OS — CID 16719201
2-(3-chlorophenyl)-N-[(E)-(3-methylsulfanylphenyl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 16719201) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[(E)-(3-methylsulfanylphenyl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-[(E)-(3-methylsulfanylphenyl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 16719201 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[(E)-(3-methylsulfanylphenyl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | CSc1cccc(/C=N/NC(=O)C2CC2c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C18H17ClN2OS/c1-23-15-7-2-4-12(8-15)11-20-21-18(22)17-10-16(17)13-5-3-6-14(19)9-13/h2-9,11,16-17H,10H2,1H3,(H,21,22)/b20-11+ |
| InChIKey | VYHCZWZMDHSLEM-RGVLZGJSSA-N |
| XLogP | 4.32 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|