C7H8N4S — CID 167202261
1-([1,2,4]triazolo[1,5-a]pyrazin-6-yl)ethanethiol (PubChem CID 167202261) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 1-([1,2,4]triazolo[1,5-a]pyrazin-6-yl)ethanethiol.
| Compound Name | 1-([1,2,4]triazolo[1,5-a]pyrazin-6-yl)ethanethiol |
|---|---|
| PubChem CID | 167202261 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 1-([1,2,4]triazolo[1,5-a]pyrazin-6-yl)ethanethiol |
| SMILES | CC(S)c1cn2ncnc2cn1 |
| InChI | InChI=1S/C7H8N4S/c1-5(12)6-3-11-7(2-8-6)9-4-10-11/h2-5,12H,1H3 |
| InChIKey | OPLWTIPSASNDLX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|