C5H4N4S — CID 163941645
[1,2,4]triazolo[1,5-a]pyrazine-6-thiol (PubChem CID 163941645) has the molecular formula C5H4N4S and a molecular weight of 152.18 g/mol. Its IUPAC name is [1,2,4]triazolo[1,5-a]pyrazine-6-thiol.
| Compound Name | [1,2,4]triazolo[1,5-a]pyrazine-6-thiol |
|---|---|
| PubChem CID | 163941645 |
| Molecular Formula | C5H4N4S |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | [1,2,4]triazolo[1,5-a]pyrazine-6-thiol |
| SMILES | Sc1cn2ncnc2cn1 |
| InChI | InChI=1S/C5H4N4S/c10-5-2-9-4(1-6-5)7-3-8-9/h1-3,10H |
| InChIKey | RRMOLDUWMSONRE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 43.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|