C8H5N3 — CID 59095683
6-ethynyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 59095683) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is 6-ethynyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-ethynyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 59095683 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 6-ethynyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | C#Cc1ccc2ncnn2c1 |
| InChI | InChI=1S/C8H5N3/c1-2-7-3-4-8-9-6-10-11(8)5-7/h1,3-6H |
| InChIKey | QKNYQTHGOWLWND-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|