C24H46N4O7S2 — CID 167214892
N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N',N'-bis[2-[(2-propan-2-ylsulfanylacetyl)amino]ethyl]butanediamide (PubChem CID 167214892) has the molecular formula C24H46N4O7S2 and a molecular weight of 566.79 g/mol. Its IUPAC name is N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N',N'-bis[2-[(2-propan-2-ylsulfanylacetyl)amino]ethyl]butanediamide.
| Compound Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N',N'-bis[2-[(2-propan-2-ylsulfanylacetyl)amino]ethyl]butanediamide |
|---|---|
| PubChem CID | 167214892 |
| Molecular Formula | C24H46N4O7S2 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N',N'-bis[2-[(2-propan-2-ylsulfanylacetyl)amino]ethyl]butanediamide |
| SMILES | CC(C)SCC(=O)NCCN(CCNC(=O)CSC(C)C)C(=O)CCC(=O)NCCOCCOCCO |
| InChI | InChI=1S/C24H46N4O7S2/c1-19(2)36-17-22(31)25-7-10-28(11-8-26-23(32)18-37-20(3)4)24(33)6-5-21(30)27-9-13-34-15-16-35-14-12-29/h19-20,29H,5-18H2,1-4H3,(H,25,31)(H,26,32)(H,27,30) |
| InChIKey | HEWFIVHJNZCJJE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|