C31H50N12O4 — CID 167214897
1-[4-[4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butylamino]-6-[4-(2-ethoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]piperidine-4-carboxylic acid (PubChem CID 167214897) has the molecular formula C31H50N12O4 and a molecular weight of 654.82 g/mol. Its IUPAC name is 1-[4-[4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butylamino]-6-[4-(2-ethoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butylamino]-6-[4-(2-ethoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 167214897 |
| Molecular Formula | C31H50N12O4 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | 1-[4-[4-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]butylamino]-6-[4-(2-ethoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]piperidine-4-carboxylic acid |
| SMILES | CCOc1ccccc1N1CCN(c2nc(NCCCCNC(=O)[C@@H](N)CCCN=C(N)N)nc(N3CCC(C(=O)O)CC3)n2)CC1 |
| InChI | InChI=1S/C31H50N12O4/c1-2-47-25-10-4-3-9-24(25)41-18-20-43(21-19-41)31-39-29(38-30(40-31)42-16-11-22(12-17-42)27(45)46)37-14-6-5-13-35-26(44)23(32)8-7-15-36-28(33)34/h3-4,9-10,22-23H,2,5-8,11-21,32H2,1H3,(H,35,44)(H,45,46)(H4,33,34,36)(H,37,38,39,40)/t23-/m0/s1 |
| InChIKey | CRAIMSOTWLIKIX-QHCPKHFHSA-N |
| XLogP | 0.59 |
| TPSA | 226.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|