C32H42N8O6 — CID 167214903
1-[4-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-6-[4-(2-ethoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]piperidine-4-carboxylic acid (PubChem CID 167214903) has the molecular formula C32H42N8O6 and a molecular weight of 634.74 g/mol. Its IUPAC name is 1-[4-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-6-[4-(2-ethoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-6-[4-(2-ethoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 167214903 |
| Molecular Formula | C32H42N8O6 |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | 1-[4-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-6-[4-(2-ethoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-yl]piperidine-4-carboxylic acid |
| SMILES | CCOc1ccccc1N1CCN(c2nc(NCCCCNC(=O)c3cccc(O)c3O)nc(N3CCC(C(=O)O)CC3)n2)CC1 |
| InChI | InChI=1S/C32H42N8O6/c1-2-46-26-11-4-3-9-24(26)38-18-20-40(21-19-38)32-36-30(35-31(37-32)39-16-12-22(13-17-39)29(44)45)34-15-6-5-14-33-28(43)23-8-7-10-25(41)27(23)42/h3-4,7-11,22,41-42H,2,5-6,12-21H2,1H3,(H,33,43)(H,44,45)(H,34,35,36,37) |
| InChIKey | OQVHEZGEOPCWJS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|