C22H32FN5O7 — CID 167223844
tert-butyl 6-[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-hydroxy-2-methyloxolan-2-yl]methoxycarbonyloxy]hexanoate (PubChem CID 167223844) has the molecular formula C22H32FN5O7 and a molecular weight of 497.52 g/mol. Its IUPAC name is tert-butyl 6-[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-hydroxy-2-methyloxolan-2-yl]methoxycarbonyloxy]hexanoate.
| Compound Name | tert-butyl 6-[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-hydroxy-2-methyloxolan-2-yl]methoxycarbonyloxy]hexanoate |
|---|---|
| PubChem CID | 167223844 |
| Molecular Formula | C22H32FN5O7 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | tert-butyl 6-[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-hydroxy-2-methyloxolan-2-yl]methoxycarbonyloxy]hexanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCOC(=O)OC[C@@]1(C)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C22H32FN5O7/c1-21(2,3)35-15(30)8-6-5-7-9-32-20(31)33-11-22(4)13(29)10-14(34-22)28-12-25-16-17(24)26-19(23)27-18(16)28/h12-14,29H,5-11H2,1-4H3,(H2,24,26,27)/t13-,14+,22+/m0/s1 |
| InChIKey | PZELEGRDZHRYKR-DJEJFTSGSA-N |
| XLogP | 2.64 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|