C29H48N6O9 — CID 167224438
2-[4-[2-[2-[[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 167224438) has the molecular formula C29H48N6O9 and a molecular weight of 624.74 g/mol. Its IUPAC name is 2-[4-[2-[2-[[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[2-[[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 167224438 |
| Molecular Formula | C29H48N6O9 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | 2-[4-[2-[2-[[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]methoxycarbonylamino]ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NCCNC(=O)OCC2[C@H]3CC/C=C\CC[C@@H]23)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C29H48N6O9/c36-25(30-7-8-31-29(43)44-21-24-22-5-3-1-2-4-6-23(22)24)17-32-9-11-33(18-26(37)38)13-15-35(20-28(41)42)16-14-34(12-10-32)19-27(39)40/h1-2,22-24H,3-21H2,(H,30,36)(H,31,43)(H,37,38)(H,39,40)(H,41,42)/b2-1-/t22-,23+,24? |
| InChIKey | KLJYXWZSMKOKCU-CSHOMILPSA-N |
| XLogP | -0.70 |
| TPSA | 192.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|