C16H23BrF3N3O2 — CID 167230766
tert-butyl N-[3-[[6-bromo-4-(trifluoromethyl)-2-pyridinyl]methyl-methylamino]propyl]carbamate (PubChem CID 167230766) has the molecular formula C16H23BrF3N3O2 and a molecular weight of 426.28 g/mol. Its IUPAC name is tert-butyl N-[3-[[6-bromo-4-(trifluoromethyl)-2-pyridinyl]methyl-methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[6-bromo-4-(trifluoromethyl)-2-pyridinyl]methyl-methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 167230766 |
| Molecular Formula | C16H23BrF3N3O2 |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | tert-butyl N-[3-[[6-bromo-4-(trifluoromethyl)-2-pyridinyl]methyl-methylamino]propyl]carbamate |
| SMILES | CN(CCCNC(=O)OC(C)(C)C)Cc1cc(C(F)(F)F)cc(Br)n1 |
| InChI | InChI=1S/C16H23BrF3N3O2/c1-15(2,3)25-14(24)21-6-5-7-23(4)10-12-8-11(16(18,19)20)9-13(17)22-12/h8-9H,5-7,10H2,1-4H3,(H,21,24) |
| InChIKey | JSLGUFNUNPABJR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|