C22H28O6Si — CID 16724452
(1S,5R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-(3,4-dioxocyclohexa-1,5-dien-1-yl)-4-methoxybicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 16724452) has the molecular formula C22H28O6Si and a molecular weight of 416.55 g/mol. Its IUPAC name is (1S,5R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-(3,4-dioxocyclohexa-1,5-dien-1-yl)-4-methoxybicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-(3,4-dioxocyclohexa-1,5-dien-1-yl)-4-methoxybicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 16724452 |
| Molecular Formula | C22H28O6Si |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (1S,5R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-(3,4-dioxocyclohexa-1,5-dien-1-yl)-4-methoxybicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | COC1=CC(=O)[C@H]2C(=O)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C1=CC(=O)C(=O)C=C1 |
| InChI | InChI=1S/C22H28O6Si/c1-22(2,3)29(5,6)28-18-10-13-17(27-4)11-16(25)20(21(13)26)19(18)12-7-8-14(23)15(24)9-12/h7-9,11,13,18-20H,10H2,1-6H3/t13-,18+,19-,20-/m1/s1 |
| InChIKey | VVAYLBJPABRWBU-ZNYHDOEXSA-N |
| XLogP | 2.95 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|