C14H10F3NS — CID 167247118
3-[1-(3,4,5-trifluoroanilino)ethenyl]benzenethiol (PubChem CID 167247118) has the molecular formula C14H10F3NS and a molecular weight of 281.30 g/mol. Its IUPAC name is 3-[1-(3,4,5-trifluoroanilino)ethenyl]benzenethiol.
| Compound Name | 3-[1-(3,4,5-trifluoroanilino)ethenyl]benzenethiol |
|---|---|
| PubChem CID | 167247118 |
| Molecular Formula | C14H10F3NS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-[1-(3,4,5-trifluoroanilino)ethenyl]benzenethiol |
| SMILES | C=C(Nc1cc(F)c(F)c(F)c1)c1cccc(S)c1 |
| InChI | InChI=1S/C14H10F3NS/c1-8(9-3-2-4-11(19)5-9)18-10-6-12(15)14(17)13(16)7-10/h2-7,18-19H,1H2 |
| InChIKey | KELWZEWPVKNRMC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|