C18H19F3N2OS — CID 167247141
3-[2-amino-5-[1-(3,4,5-trifluoroanilino)ethenyl]phenyl]sulfanyl-2-methylpropan-1-ol (PubChem CID 167247141) has the molecular formula C18H19F3N2OS and a molecular weight of 368.42 g/mol. Its IUPAC name is 3-[2-amino-5-[1-(3,4,5-trifluoroanilino)ethenyl]phenyl]sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-[2-amino-5-[1-(3,4,5-trifluoroanilino)ethenyl]phenyl]sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 167247141 |
| Molecular Formula | C18H19F3N2OS |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 3-[2-amino-5-[1-(3,4,5-trifluoroanilino)ethenyl]phenyl]sulfanyl-2-methylpropan-1-ol |
| SMILES | C=C(Nc1cc(F)c(F)c(F)c1)c1ccc(N)c(SCC(C)CO)c1 |
| InChI | InChI=1S/C18H19F3N2OS/c1-10(8-24)9-25-17-5-12(3-4-16(17)22)11(2)23-13-6-14(19)18(21)15(20)7-13/h3-7,10,23-24H,2,8-9,22H2,1H3 |
| InChIKey | QXSLSQNQWZWIQE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|