C25H30ClF3N2O4S — CID 145366628
4-chloro-3-[2-(2-hydroxy-1-methylcyclopropyl)-3-[2-(1-hydroxypropan-2-ylamino)ethoxy]propyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 145366628) has the molecular formula C25H30ClF3N2O4S and a molecular weight of 547.04 g/mol. Its IUPAC name is 4-chloro-3-[2-(2-hydroxy-1-methylcyclopropyl)-3-[2-(1-hydroxypropan-2-ylamino)ethoxy]propyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[2-(2-hydroxy-1-methylcyclopropyl)-3-[2-(1-hydroxypropan-2-ylamino)ethoxy]propyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 145366628 |
| Molecular Formula | C25H30ClF3N2O4S |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 4-chloro-3-[2-(2-hydroxy-1-methylcyclopropyl)-3-[2-(1-hydroxypropan-2-ylamino)ethoxy]propyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(CO)NCCOCC(CSc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl)C1(C)CC1O |
| InChI | InChI=1S/C25H30ClF3N2O4S/c1-14(11-32)30-5-6-35-12-16(25(2)10-22(25)33)13-36-21-7-15(3-4-18(21)26)24(34)31-17-8-19(27)23(29)20(28)9-17/h3-4,7-9,14,16,22,30,32-33H,5-6,10-13H2,1-2H3,(H,31,34) |
| InChIKey | LRJPPIPHTVNAHK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|