C19H29NO3 — CID 167253175
(E)-N-[4-(cyclobuten-1-yl)-3,3-dimethyl-4-oxobutyl]-N,5,5-trimethyl-4-oxohex-2-enamide (PubChem CID 167253175) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (E)-N-[4-(cyclobuten-1-yl)-3,3-dimethyl-4-oxobutyl]-N,5,5-trimethyl-4-oxohex-2-enamide.
| Compound Name | (E)-N-[4-(cyclobuten-1-yl)-3,3-dimethyl-4-oxobutyl]-N,5,5-trimethyl-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 167253175 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (E)-N-[4-(cyclobuten-1-yl)-3,3-dimethyl-4-oxobutyl]-N,5,5-trimethyl-4-oxohex-2-enamide |
| SMILES | CN(CCC(C)(C)C(=O)C1=CCC1)C(=O)/C=C/C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H29NO3/c1-18(2,3)15(21)10-11-16(22)20(6)13-12-19(4,5)17(23)14-8-7-9-14/h8,10-11H,7,9,12-13H2,1-6H3/b11-10+ |
| InChIKey | FPYMIQOWVUEUNJ-ZHACJKMWSA-N |
| XLogP | 3.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|