C9H14N2O4 — CID 167255120
N-(2,2-dimethoxyethyl)-2-methyl-1,3-oxazole-4-carboxamide (PubChem CID 167255120) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 167255120 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-methyl-1,3-oxazole-4-carboxamide |
| SMILES | COC(CNC(=O)c1coc(C)n1)OC |
| InChI | InChI=1S/C9H14N2O4/c1-6-11-7(5-15-6)9(12)10-4-8(13-2)14-3/h5,8H,4H2,1-3H3,(H,10,12) |
| InChIKey | SXGJAQHFCWLOFM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|