C23H24N4O8 — CID 167258698
[(2S,4R,5S)-5-[4-(acetyloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxyoxolan-2-yl]methyl 2-phenylacetate (PubChem CID 167258698) has the molecular formula C23H24N4O8 and a molecular weight of 484.47 g/mol. Its IUPAC name is [(2S,4R,5S)-5-[4-(acetyloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxyoxolan-2-yl]methyl 2-phenylacetate.
| Compound Name | [(2S,4R,5S)-5-[4-(acetyloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxyoxolan-2-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 167258698 |
| Molecular Formula | C23H24N4O8 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | [(2S,4R,5S)-5-[4-(acetyloxymethoxycarbonylamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxyoxolan-2-yl]methyl 2-phenylacetate |
| SMILES | CC(=O)OCOC(=O)Nc1ncnn2c([C@@H]3O[C@H](COC(=O)Cc4ccccc4)C[C@H]3O)ccc12 |
| InChI | InChI=1S/C23H24N4O8/c1-14(28)33-13-34-23(31)26-22-18-8-7-17(27(18)25-12-24-22)21-19(29)10-16(35-21)11-32-20(30)9-15-5-3-2-4-6-15/h2-8,12,16,19,21,29H,9-11,13H2,1H3,(H,24,25,26,31)/t16-,19+,21-/m0/s1 |
| InChIKey | ZKZGEEQJUNVFOR-SCWSEQNSSA-N |
| XLogP | 1.78 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|