C21H29NO3 — CID 167261599
tert-butyl N-ethyl-N-[(1S,9S,10S)-4-hydroxy-9-tetracyclo[8.4.0.01,12.02,7]tetradeca-2(7),3,5-trienyl]carbamate (PubChem CID 167261599) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[(1S,9S,10S)-4-hydroxy-9-tetracyclo[8.4.0.01,12.02,7]tetradeca-2(7),3,5-trienyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[(1S,9S,10S)-4-hydroxy-9-tetracyclo[8.4.0.01,12.02,7]tetradeca-2(7),3,5-trienyl]carbamate |
|---|---|
| PubChem CID | 167261599 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | tert-butyl N-ethyl-N-[(1S,9S,10S)-4-hydroxy-9-tetracyclo[8.4.0.01,12.02,7]tetradeca-2(7),3,5-trienyl]carbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)[C@H]1Cc2ccc(O)cc2[C@@]23CCC2C[C@H]13 |
| InChI | InChI=1S/C21H29NO3/c1-5-22(19(24)25-20(2,3)4)18-10-13-6-7-15(23)12-16(13)21-9-8-14(21)11-17(18)21/h6-7,12,14,17-18,23H,5,8-11H2,1-4H3/t14?,17-,18+,21-/m1/s1 |
| InChIKey | PLFDMOGXQITLJY-BEWIMKILSA-N |
| XLogP | 4.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |